C23H27NO10 — CID 58482218
[2-[4-(1-nitrooxyethoxycarbonyloxy)butoxy]-2-oxoethyl] (2S)-2-(6-methylnaphthalen-2-yl)propanoate (PubChem CID 58482218) has the molecular formula C23H27NO10 and a molecular weight of 477.47 g/mol. Its IUPAC name is [2-[4-(1-nitrooxyethoxycarbonyloxy)butoxy]-2-oxoethyl] (2S)-2-(6-methylnaphthalen-2-yl)propanoate.
| Compound Name | [2-[4-(1-nitrooxyethoxycarbonyloxy)butoxy]-2-oxoethyl] (2S)-2-(6-methylnaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 58482218 |
| Molecular Formula | C23H27NO10 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [2-[4-(1-nitrooxyethoxycarbonyloxy)butoxy]-2-oxoethyl] (2S)-2-(6-methylnaphthalen-2-yl)propanoate |
| SMILES | Cc1ccc2cc([C@H](C)C(=O)OCC(=O)OCCCCOC(=O)OC(C)O[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C23H27NO10/c1-15-6-7-20-13-18(8-9-19(20)12-15)16(2)22(26)32-14-21(25)30-10-4-5-11-31-23(27)33-17(3)34-24(28)29/h6-9,12-13,16-17H,4-5,10-11,14H2,1-3H3/t16-,17?/m0/s1 |
| InChIKey | FMPCXFUILLQWKP-BHWOMJMDSA-N |
| XLogP | 3.83 |
| TPSA | 140.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|