C22H27NO9 — CID 54578871
[2,2-dimethyl-3-(1-nitrooxyethoxycarbonyloxy)propyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 54578871) has the molecular formula C22H27NO9 and a molecular weight of 449.46 g/mol. Its IUPAC name is [2,2-dimethyl-3-(1-nitrooxyethoxycarbonyloxy)propyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [2,2-dimethyl-3-(1-nitrooxyethoxycarbonyloxy)propyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 54578871 |
| Molecular Formula | C22H27NO9 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [2,2-dimethyl-3-(1-nitrooxyethoxycarbonyloxy)propyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCC(C)(C)COC(=O)OC(C)O[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C22H27NO9/c1-14(16-6-7-18-11-19(28-5)9-8-17(18)10-16)20(24)29-12-22(3,4)13-30-21(25)31-15(2)32-23(26)27/h6-11,14-15H,12-13H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | QNRJFTHOSKDOMD-MLCCFXAWSA-N |
| XLogP | 4.23 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|