C20H23NO7 — CID 58083689
[2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(6-methylnaphthalen-2-yl)propanoate (PubChem CID 58083689) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(6-methylnaphthalen-2-yl)propanoate.
| Compound Name | [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(6-methylnaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 58083689 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [2-(4-nitrooxybutoxy)-2-oxoethyl] 2-(6-methylnaphthalen-2-yl)propanoate |
| SMILES | Cc1ccc2cc(C(C)C(=O)OCC(=O)OCCCCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C20H23NO7/c1-14-5-6-18-12-16(7-8-17(18)11-14)15(2)20(23)27-13-19(22)26-9-3-4-10-28-21(24)25/h5-8,11-12,15H,3-4,9-10,13H2,1-2H3 |
| InChIKey | JDRWPIHWVVQEBG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|