C22H28O3 — CID 146714639
butyl (2R,5S)-2-methyl-5-(6-methylnaphthalen-2-yl)-4-oxohexanoate (PubChem CID 146714639) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is butyl (2R,5S)-2-methyl-5-(6-methylnaphthalen-2-yl)-4-oxohexanoate.
| Compound Name | butyl (2R,5S)-2-methyl-5-(6-methylnaphthalen-2-yl)-4-oxohexanoate |
|---|---|
| PubChem CID | 146714639 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | butyl (2R,5S)-2-methyl-5-(6-methylnaphthalen-2-yl)-4-oxohexanoate |
| SMILES | CCCCOC(=O)[C@H](C)CC(=O)[C@@H](C)c1ccc2cc(C)ccc2c1 |
| InChI | InChI=1S/C22H28O3/c1-5-6-11-25-22(24)16(3)13-21(23)17(4)18-9-10-19-12-15(2)7-8-20(19)14-18/h7-10,12,14,16-17H,5-6,11,13H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | RDEHGQAXUUUAJO-SJORKVTESA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|