C18H23NO5 — CID 89184538
4-(dihydroxyamino)oxybutyl 2-(6-methylnaphthalen-2-yl)propanoate (PubChem CID 89184538) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 2-(6-methylnaphthalen-2-yl)propanoate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 2-(6-methylnaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 89184538 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 2-(6-methylnaphthalen-2-yl)propanoate |
| SMILES | Cc1ccc2cc(C(C)C(=O)OCCCCON(O)O)ccc2c1 |
| InChI | InChI=1S/C18H23NO5/c1-13-5-6-17-12-15(7-8-16(17)11-13)14(2)18(20)23-9-3-4-10-24-19(21)22/h5-8,11-12,14,21-22H,3-4,9-10H2,1-2H3 |
| InChIKey | IMLRGWYVUAIYGR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|