About ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate
ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate (PubChem CID 144534481) has the molecular formula C23H31BrO4
and a molecular weight of 451.40 g/mol. Its IUPAC name is ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate.
Molecular Properties
| Compound Name | ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate |
| PubChem CID | 144534481 |
| Molecular Formula | C23H31BrO4 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate |
| SMILES | CC.CC(C(=O)OC(C)(C)C)c1ccc2cc(OC(=O)CCCBr)ccc2c1 |
| InChI | InChI=1S/C21H25BrO4.C2H6/c1-14(20(24)26-21(2,3)4)15-7-8-17-13-18(10-9-16(17)12-15)25-19(23)6-5-11-22;1-2/h7-10,12-14H,5-6,11H2,1-4H3;1-2H3 |
| InChIKey | NOXWGDFEJBOZDO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate?
The IUPAC name of ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate (CID 144534481) is ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate.
What is the SMILES notation for ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate?
The canonical SMILES for ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate is CC.CC(C(=O)OC(C)(C)C)c1ccc2cc(OC(=O)CCCBr)ccc2c1.
What is the InChIKey of ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate?
The InChIKey is NOXWGDFEJBOZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25BrO4.C2H6/c1-14(20(24)26-21(2,3)4)15-7-8-17-13-18(10-9-16(17)12-15)25-19(23)6-5-11-22;1-2/h7-10,12-14H,5-6,11H2,1-4H3;1-2H3.
What are the key properties of ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate?
ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate has a molecular weight of 451.40 g/mol, XLogP of 6.39, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[6-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]naphthalen-2-yl] 4-bromobutanoate is sourced from PubChem (CID 144534481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).