C16H19N3O9S2 — CID 130416382
[2-(2,3-dinitrooxypropylcarbamoyl)phenyl] 3-(prop-2-enyldisulfanyl)propanoate (PubChem CID 130416382) has the molecular formula C16H19N3O9S2 and a molecular weight of 461.47 g/mol. Its IUPAC name is [2-(2,3-dinitrooxypropylcarbamoyl)phenyl] 3-(prop-2-enyldisulfanyl)propanoate.
| Compound Name | [2-(2,3-dinitrooxypropylcarbamoyl)phenyl] 3-(prop-2-enyldisulfanyl)propanoate |
|---|---|
| PubChem CID | 130416382 |
| Molecular Formula | C16H19N3O9S2 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | [2-(2,3-dinitrooxypropylcarbamoyl)phenyl] 3-(prop-2-enyldisulfanyl)propanoate |
| SMILES | C=CCSSCCC(=O)Oc1ccccc1C(=O)NCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O9S2/c1-2-8-29-30-9-7-15(20)27-14-6-4-3-5-13(14)16(21)17-10-12(28-19(24)25)11-26-18(22)23/h2-6,12H,1,7-11H2,(H,17,21) |
| InChIKey | UGPWJMXKQWRSES-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|