C13H15N3O9 — CID 59407356
[1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-nitrooxypropan-2-yl] nitrate (PubChem CID 59407356) has the molecular formula C13H15N3O9 and a molecular weight of 357.28 g/mol. Its IUPAC name is [1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-nitrooxypropan-2-yl] nitrate.
| Compound Name | [1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-nitrooxypropan-2-yl] nitrate |
|---|---|
| PubChem CID | 59407356 |
| Molecular Formula | C13H15N3O9 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-nitrooxypropan-2-yl] nitrate |
| SMILES | COc1cc(/C=C/C(=O)NCC(CO[N+](=O)[O-])O[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C13H15N3O9/c1-23-12-6-9(2-4-11(12)17)3-5-13(18)14-7-10(25-16(21)22)8-24-15(19)20/h2-6,10,17H,7-8H2,1H3,(H,14,18)/b5-3+ |
| InChIKey | VEBBZVKYNNFYTB-HWKANZROSA-N |
| XLogP | 0.32 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|