C12H13N3O9 — CID 59407408
[1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-2-nitrooxyethyl] nitrate (PubChem CID 59407408) has the molecular formula C12H13N3O9 and a molecular weight of 343.25 g/mol. Its IUPAC name is [1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-2-nitrooxyethyl] nitrate.
| Compound Name | [1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-2-nitrooxyethyl] nitrate |
|---|---|
| PubChem CID | 59407408 |
| Molecular Formula | C12H13N3O9 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [1-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-2-nitrooxyethyl] nitrate |
| SMILES | COc1cc(/C=C/C(=O)NC(CO[N+](=O)[O-])O[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C12H13N3O9/c1-22-10-6-8(2-4-9(10)16)3-5-11(17)13-12(24-15(20)21)7-23-14(18)19/h2-6,12,16H,7H2,1H3,(H,13,17)/b5-3+ |
| InChIKey | CRTAPDNMIZIRTG-HWKANZROSA-N |
| XLogP | 0.27 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|