C17H24N2O4S3 — CID 129259309
2-[1-hydroxy-3-(prop-2-enyldisulfanyl)propoxy]-N-(2-methyl-2-nitrososulfanylpropyl)benzamide (PubChem CID 129259309) has the molecular formula C17H24N2O4S3 and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[1-hydroxy-3-(prop-2-enyldisulfanyl)propoxy]-N-(2-methyl-2-nitrososulfanylpropyl)benzamide.
| Compound Name | 2-[1-hydroxy-3-(prop-2-enyldisulfanyl)propoxy]-N-(2-methyl-2-nitrososulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 129259309 |
| Molecular Formula | C17H24N2O4S3 |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[1-hydroxy-3-(prop-2-enyldisulfanyl)propoxy]-N-(2-methyl-2-nitrososulfanylpropyl)benzamide |
| SMILES | C=CCSSCCC(O)Oc1ccccc1C(=O)NCC(C)(C)SN=O |
| InChI | InChI=1S/C17H24N2O4S3/c1-4-10-24-25-11-9-15(20)23-14-8-6-5-7-13(14)16(21)18-12-17(2,3)26-19-22/h4-8,15,20H,1,9-12H2,2-3H3,(H,18,21) |
| InChIKey | RXHSNTYKTQOPRK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|