C16H23NO7 — CID 66976703
2-acetyloxybenzoic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 66976703) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 2-acetyloxybenzoic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 66976703 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-acetyloxybenzoic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.C[N+](C)(C)C[C@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C9H8O4.C7H15NO3/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;1-8(2,3)5-6(9)4-7(10)11/h2-5H,1H3,(H,11,12);6,9H,4-5H2,1-3H3/t;6-/m.1/s1 |
| InChIKey | YZDLVICYYULVOV-FCXZQVPUSA-N |
| XLogP | -0.50 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|