C15H24ClNO4 — CID 174781417
formyl chloride;3-hydroxy-4-(trimethylazaniumyl)butanoate;toluene (PubChem CID 174781417) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is formyl chloride;3-hydroxy-4-(trimethylazaniumyl)butanoate;toluene.
| Compound Name | formyl chloride;3-hydroxy-4-(trimethylazaniumyl)butanoate;toluene |
|---|---|
| PubChem CID | 174781417 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | formyl chloride;3-hydroxy-4-(trimethylazaniumyl)butanoate;toluene |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-].Cc1ccccc1.O=CCl |
| InChI | InChI=1S/C7H15NO3.C7H8.CHClO/c1-8(2,3)5-6(9)4-7(10)11;1-7-5-3-2-4-6-7;2-1-3/h6,9H,4-5H2,1-3H3;2-6H,1H3;1H |
| InChIKey | SIAJVSWBXHFFBA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|