C25H29NO11 — CID 70363077
2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 70363077) has the molecular formula C25H29NO11 and a molecular weight of 519.50 g/mol. Its IUPAC name is 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 70363077 |
| Molecular Formula | C25H29NO11 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-].O=C(OC(C(=O)O)(C(=O)c1ccccc1)C(O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C7H15NO3/c19-13(11-7-3-1-4-8-11)18(17(24)25,14(20)15(21)22)26-16(23)12-9-5-2-6-10-12;1-8(2,3)5-6(9)4-7(10)11/h1-10,14,20H,(H,21,22)(H,24,25);6,9H,4-5H2,1-3H3 |
| InChIKey | SVWKABXMZBTELQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|