C19H16O9 — CID 174728342
(3R)-3-benzoyl-3-benzoyloxy-2-hydroxy-4-methylperoxy-4-oxobutanoic acid (PubChem CID 174728342) has the molecular formula C19H16O9 and a molecular weight of 388.33 g/mol. Its IUPAC name is (3R)-3-benzoyl-3-benzoyloxy-2-hydroxy-4-methylperoxy-4-oxobutanoic acid.
| Compound Name | (3R)-3-benzoyl-3-benzoyloxy-2-hydroxy-4-methylperoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174728342 |
| Molecular Formula | C19H16O9 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (3R)-3-benzoyl-3-benzoyloxy-2-hydroxy-4-methylperoxy-4-oxobutanoic acid |
| SMILES | COOC(=O)[C@](OC(=O)c1ccccc1)(C(=O)c1ccccc1)C(O)C(=O)O |
| InChI | InChI=1S/C19H16O9/c1-26-28-18(25)19(15(21)16(22)23,14(20)12-8-4-2-5-9-12)27-17(24)13-10-6-3-7-11-13/h2-11,15,21H,1H3,(H,22,23)/t15?,19-/m0/s1 |
| InChIKey | LTGMHGZPSSMJFP-FUBQLUNQSA-N |
| XLogP | 1.02 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|