C18H14O8 — CID 87139613
(2S,3S)-3-benzoyl-4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 87139613) has the molecular formula C18H14O8 and a molecular weight of 358.30 g/mol. Its IUPAC name is (2S,3S)-3-benzoyl-4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | (2S,3S)-3-benzoyl-4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87139613 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (2S,3S)-3-benzoyl-4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | O=C(OC(=O)[C@@](O)(C(=O)c1ccccc1)[C@H](O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8/c19-13(11-7-3-1-4-8-11)18(25,14(20)15(21)22)17(24)26-16(23)12-9-5-2-6-10-12/h1-10,14,20,25H,(H,21,22)/t14-,18-/m1/s1 |
| InChIKey | XWENLPDRXQTEPZ-RDTXWAMCSA-N |
| XLogP | 0.43 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|