C11H9KO7 — CID 67717509
potassium (2R,3S)-2-benzoyl-2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 67717509) has the molecular formula C11H9KO7 and a molecular weight of 292.28 g/mol. Its IUPAC name is potassium (2R,3S)-2-benzoyl-2,3,4-trihydroxy-4-oxobutanoate.
| Compound Name | potassium (2R,3S)-2-benzoyl-2,3,4-trihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 67717509 |
| Molecular Formula | C11H9KO7 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | potassium (2R,3S)-2-benzoyl-2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | O=C(O)[C@@H](O)[C@](O)(C(=O)[O-])C(=O)c1ccccc1.[K+] |
| InChI | InChI=1S/C11H10O7.K/c12-7(6-4-2-1-3-5-6)11(18,10(16)17)8(13)9(14)15;/h1-5,8,13,18H,(H,14,15)(H,16,17);/q;+1/p-1/t8-,11+;/m1./s1 |
| InChIKey | VMLQFPTYGGJXGY-NINOIYOQSA-M |
| XLogP | -5.20 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|