C22H22O15 — CID 174359329
bis(4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid);hydrate (PubChem CID 174359329) has the molecular formula C22H22O15 and a molecular weight of 526.40 g/mol. Its IUPAC name is bis(4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid);hydrate.
| Compound Name | bis(4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid);hydrate |
|---|---|
| PubChem CID | 174359329 |
| Molecular Formula | C22H22O15 |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | bis(4-benzoyloxy-2,3-dihydroxy-4-oxobutanoic acid);hydrate |
| SMILES | O.O=C(OC(=O)C(O)C(O)C(=O)O)c1ccccc1.O=C(OC(=O)C(O)C(O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/2C11H10O7.H2O/c2*12-7(9(14)15)8(13)11(17)18-10(16)6-4-2-1-3-5-6;/h2*1-5,7-8,12-13H,(H,14,15);1H2 |
| InChIKey | DYNKUGQVUMOVLT-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 273.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|