C22H20O14 — CID 158220353
dibenzoyl 2,3-dihydroxybutanedioate;2,3-dihydroxybutanedioic acid (PubChem CID 158220353) has the molecular formula C22H20O14 and a molecular weight of 508.39 g/mol. Its IUPAC name is dibenzoyl 2,3-dihydroxybutanedioate;2,3-dihydroxybutanedioic acid.
| Compound Name | dibenzoyl 2,3-dihydroxybutanedioate;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 158220353 |
| Molecular Formula | C22H20O14 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | dibenzoyl 2,3-dihydroxybutanedioate;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C(OC(=O)C(O)C(O)C(=O)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C4H6O6/c19-13(17(23)25-15(21)11-7-3-1-4-8-11)14(20)18(24)26-16(22)12-9-5-2-6-10-12;5-1(3(7)8)2(6)4(9)10/h1-10,13-14,19-20H;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | GDDZCYJRHQJOPH-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|