C22H20O13 — CID 175757584
dibenzoyl 2,3-dihydroxybutanedioate;(2S)-2-hydroxybutanedioic acid (PubChem CID 175757584) has the molecular formula C22H20O13 and a molecular weight of 492.39 g/mol. Its IUPAC name is dibenzoyl 2,3-dihydroxybutanedioate;(2S)-2-hydroxybutanedioic acid.
| Compound Name | dibenzoyl 2,3-dihydroxybutanedioate;(2S)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175757584 |
| Molecular Formula | C22H20O13 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | dibenzoyl 2,3-dihydroxybutanedioate;(2S)-2-hydroxybutanedioic acid |
| SMILES | O=C(O)C[C@H](O)C(=O)O.O=C(OC(=O)C(O)C(O)C(=O)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C4H6O5/c19-13(17(23)25-15(21)11-7-3-1-4-8-11)14(20)18(24)26-16(22)12-9-5-2-6-10-12;5-2(4(8)9)1-3(6)7/h1-10,13-14,19-20H;2,5H,1H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | GQQLJKHQXHAPRD-WNQIDUERSA-N |
| XLogP | -0.62 |
| TPSA | 222.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|