About (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate
(2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate (PubChem CID 141300384) has the molecular formula C17H16O8
and a molecular weight of 348.31 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate.
Molecular Properties
| Compound Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate |
| PubChem CID | 141300384 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate |
| SMILES | O.O=C(OC(=O)[C@H](O)[C@@H](O)C(=O)O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H14O7.H2O/c18-13(15(20)21)14(19)17(23)24-16(22)12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13-14,18-19H,(H,20,21);1H2/t13-,14-;/m1./s1 |
| InChIKey | ZECYFOQPMIZSEW-DTPOWOMPSA-N |
| XLogP | 0.02 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate?
The IUPAC name of (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate (CID 141300384) is (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate.
What is the SMILES notation for (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate?
The canonical SMILES for (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate is O.O=C(OC(=O)[C@H](O)[C@@H](O)C(=O)O)c1ccccc1-c1ccccc1.
What is the InChIKey of (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate?
The InChIKey is ZECYFOQPMIZSEW-DTPOWOMPSA-N. The full InChI is InChI=1S/C17H14O7.H2O/c18-13(15(20)21)14(19)17(23)24-16(22)12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13-14,18-19H,(H,20,21);1H2/t13-,14-;/m1./s1.
What are the key properties of (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate?
(2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate has a molecular weight of 348.31 g/mol, XLogP of 0.02, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-dihydroxy-4-oxo-4-(2-phenylbenzoyl)oxybutanoic acid;hydrate is sourced from PubChem (CID 141300384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).