C22H18O13 — CID 68754438
2-(2,3-dibenzoyloxy-3-carboxypropanoyl)oxy-3-hydroxybutanedioic acid (PubChem CID 68754438) has the molecular formula C22H18O13 and a molecular weight of 490.37 g/mol. Its IUPAC name is 2-(2,3-dibenzoyloxy-3-carboxypropanoyl)oxy-3-hydroxybutanedioic acid.
| Compound Name | 2-(2,3-dibenzoyloxy-3-carboxypropanoyl)oxy-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 68754438 |
| Molecular Formula | C22H18O13 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-(2,3-dibenzoyloxy-3-carboxypropanoyl)oxy-3-hydroxybutanedioic acid |
| SMILES | O=C(OC(C(=O)O)C(OC(=O)c1ccccc1)C(=O)OC(C(=O)O)C(O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H18O13/c23-13(17(24)25)14(18(26)27)33-22(32)16(35-21(31)12-9-5-2-6-10-12)15(19(28)29)34-20(30)11-7-3-1-4-8-11/h1-10,13-16,23H,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | PLWINOOZZUMRIH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 211.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|