C18H13O8- — CID 3250275
2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate (PubChem CID 3250275) has the molecular formula C18H13O8- and a molecular weight of 357.29 g/mol. Its IUPAC name is 2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate.
| Compound Name | 2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 3250275 |
| Molecular Formula | C18H13O8- |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate |
| SMILES | O=C(OC(C(=O)[O-])C(OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h1-10,13-14H,(H,19,20)(H,21,22)/p-1 |
| InChIKey | YONLFQNRGZXBBF-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |