C25H20N2O8 — CID 41301714
(2R,3S)-4-(2-benzoylhydrazinyl)-2,3-dibenzoyloxy-4-oxobutanoic acid (PubChem CID 41301714) has the molecular formula C25H20N2O8 and a molecular weight of 476.44 g/mol. Its IUPAC name is (2R,3S)-4-(2-benzoylhydrazinyl)-2,3-dibenzoyloxy-4-oxobutanoic acid.
| Compound Name | (2R,3S)-4-(2-benzoylhydrazinyl)-2,3-dibenzoyloxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 41301714 |
| Molecular Formula | C25H20N2O8 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | (2R,3S)-4-(2-benzoylhydrazinyl)-2,3-dibenzoyloxy-4-oxobutanoic acid |
| SMILES | O=C(NNC(=O)[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O8/c28-21(16-10-4-1-5-11-16)26-27-22(29)19(34-24(32)17-12-6-2-7-13-17)20(23(30)31)35-25(33)18-14-8-3-9-15-18/h1-15,19-20H,(H,26,28)(H,27,29)(H,30,31)/t19-,20+/m0/s1 |
| InChIKey | WDPIHOYEGTXGQT-VQTJNVASSA-N |
| XLogP | 1.98 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|