C27H21Cl2N3O9 — CID 126381195
(2R,3S)-4-[2-(4-acetamidobenzoyl)hydrazinyl]-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 126381195) has the molecular formula C27H21Cl2N3O9 and a molecular weight of 602.38 g/mol. Its IUPAC name is (2R,3S)-4-[2-(4-acetamidobenzoyl)hydrazinyl]-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2R,3S)-4-[2-(4-acetamidobenzoyl)hydrazinyl]-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126381195 |
| Molecular Formula | C27H21Cl2N3O9 |
| Molecular Weight | 602.38 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | (2R,3S)-4-[2-(4-acetamidobenzoyl)hydrazinyl]-2,3-bis[(2-chlorobenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)NNC(=O)[C@@H](OC(=O)c2ccccc2Cl)[C@@H](OC(=O)c2ccccc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C27H21Cl2N3O9/c1-14(33)30-16-12-10-15(11-13-16)23(34)31-32-24(35)21(40-26(38)17-6-2-4-8-19(17)28)22(25(36)37)41-27(39)18-7-3-5-9-20(18)29/h2-13,21-22H,1H3,(H,30,33)(H,31,34)(H,32,35)(H,36,37)/t21-,22+/m0/s1 |
| InChIKey | BTGZBCGMMPPGGF-FCHUYYIVSA-N |
| XLogP | 3.25 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|