C29H20Cl2N2O8 — CID 126385689
(2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-[2-(naphthalene-1-carbonyl)hydrazinyl]-4-oxobutanoic acid (PubChem CID 126385689) has the molecular formula C29H20Cl2N2O8 and a molecular weight of 595.39 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-[2-(naphthalene-1-carbonyl)hydrazinyl]-4-oxobutanoic acid.
| Compound Name | (2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-[2-(naphthalene-1-carbonyl)hydrazinyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126385689 |
| Molecular Formula | C29H20Cl2N2O8 |
| Molecular Weight | 595.39 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | (2R,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-[2-(naphthalene-1-carbonyl)hydrazinyl]-4-oxobutanoic acid |
| SMILES | O=C(O[C@@H](C(=O)O)[C@@H](OC(=O)c1ccccc1Cl)C(=O)NNC(=O)c1cccc2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C29H20Cl2N2O8/c30-21-14-5-3-11-19(21)28(38)40-23(24(27(36)37)41-29(39)20-12-4-6-15-22(20)31)26(35)33-32-25(34)18-13-7-9-16-8-1-2-10-17(16)18/h1-15,23-24H,(H,32,34)(H,33,35)(H,36,37)/t23-,24-/m1/s1 |
| InChIKey | FBYSDTMOOCNDLK-DNQXCXABSA-N |
| XLogP | 4.44 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|