C24H16Cl2INO7 — CID 126385192
(2S,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-(4-iodoanilino)-4-oxobutanoic acid (PubChem CID 126385192) has the molecular formula C24H16Cl2INO7 and a molecular weight of 628.20 g/mol. Its IUPAC name is (2S,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-(4-iodoanilino)-4-oxobutanoic acid.
| Compound Name | (2S,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-(4-iodoanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126385192 |
| Molecular Formula | C24H16Cl2INO7 |
| Molecular Weight | 628.20 g/mol |
| Exact Mass | 626.93 |
| IUPAC Name | (2S,3R)-2,3-bis[(2-chlorobenzoyl)oxy]-4-(4-iodoanilino)-4-oxobutanoic acid |
| SMILES | O=C(O[C@H](C(=O)O)[C@@H](OC(=O)c1ccccc1Cl)C(=O)Nc1ccc(I)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C24H16Cl2INO7/c25-17-7-3-1-5-15(17)23(32)34-19(21(29)28-14-11-9-13(27)10-12-14)20(22(30)31)35-24(33)16-6-2-4-8-18(16)26/h1-12,19-20H,(H,28,29)(H,30,31)/t19-,20+/m1/s1 |
| InChIKey | ADTUSSXTAJCWFM-UXHICEINSA-N |
| XLogP | 5.07 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|