(2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid

C12H10O9 — CID 171380866

IUPAC(2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid
SMILESO=C(O)O[C@H](C(=O)O)[C@H](OC(=O)c1ccccc1)C(=O)O
InChIInChI=1S/C12H10O9/c13-9(14)7(8(10(15)16)21-12(18)19)20-11(17)6-4-2-1-3-5-6/h1-5,7-8H,(H,13,14)(H,15,16)(H,18,19)/t7-,8-/m0/s1
InChIKeyCSCDFQYPPPVDDB-YUMQZZPRSA-N
MW298.20 g/mol
LogP0.44
Rot. Bonds6

About (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid

(2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid (PubChem CID 171380866) has the molecular formula C12H10O9 and a molecular weight of 298.20 g/mol. Its IUPAC name is (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid.

Molecular Properties

Compound Name(2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid
PubChem CID171380866
Molecular FormulaC12H10O9
Molecular Weight298.20 g/mol
Exact Mass298.03
IUPAC Name(2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid
SMILESO=C(O)O[C@H](C(=O)O)[C@H](OC(=O)c1ccccc1)C(=O)O
InChIInChI=1S/C12H10O9/c13-9(14)7(8(10(15)16)21-12(18)19)20-11(17)6-4-2-1-3-5-6/h1-5,7-8H,(H,13,14)(H,15,16)(H,18,19)/t7-,8-/m0/s1
InChIKeyCSCDFQYPPPVDDB-YUMQZZPRSA-N
XLogP0.44
TPSA147.43 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.20
LogP ≤ 50.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid?
The IUPAC name of (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid (CID 171380866) is (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid.
What is the SMILES notation for (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid?
The canonical SMILES for (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid is O=C(O)O[C@H](C(=O)O)[C@H](OC(=O)c1ccccc1)C(=O)O.
What is the InChIKey of (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid?
The InChIKey is CSCDFQYPPPVDDB-YUMQZZPRSA-N. The full InChI is InChI=1S/C12H10O9/c13-9(14)7(8(10(15)16)21-12(18)19)20-11(17)6-4-2-1-3-5-6/h1-5,7-8H,(H,13,14)(H,15,16)(H,18,19)/t7-,8-/m0/s1.
What are the key properties of (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid?
(2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid has a molecular weight of 298.20 g/mol, XLogP of 0.44, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-benzoyloxy-3-carboxyoxybutanedioic acid is sourced from PubChem (CID 171380866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).