C13H23NO11 — CID 87426117
1,2-dihydroxypropane-1,2,3-tricarboxylic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 87426117) has the molecular formula C13H23NO11 and a molecular weight of 369.32 g/mol. Its IUPAC name is 1,2-dihydroxypropane-1,2,3-tricarboxylic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 1,2-dihydroxypropane-1,2,3-tricarboxylic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 87426117 |
| Molecular Formula | C13H23NO11 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1,2-dihydroxypropane-1,2,3-tricarboxylic acid;(3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)C[C@H](O)CC(=O)[O-].O=C(O)CC(O)(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C7H15NO3.C6H8O8/c1-8(2,3)5-6(9)4-7(10)11;7-2(8)1-6(14,5(12)13)3(9)4(10)11/h6,9H,4-5H2,1-3H3;3,9,14H,1H2,(H,7,8)(H,10,11)(H,12,13)/t6-;/m1./s1 |
| InChIKey | QGPLPWPQBZHMPK-FYZOBXCZSA-N |
| XLogP | -4.08 |
| TPSA | 212.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|