C12H25ClN2O7 — CID 174390447
2-aminopentanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride (PubChem CID 174390447) has the molecular formula C12H25ClN2O7 and a molecular weight of 344.79 g/mol. Its IUPAC name is 2-aminopentanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride.
| Compound Name | 2-aminopentanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 174390447 |
| Molecular Formula | C12H25ClN2O7 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-aminopentanedioic acid;3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-].Cl.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H15NO3.C5H9NO4.ClH/c1-8(2,3)5-6(9)4-7(10)11;6-3(5(9)10)1-2-4(7)8;/h6,9H,4-5H2,1-3H3;3H,1-2,6H2,(H,7,8)(H,9,10);1H |
| InChIKey | MAQDLPYLSFIDIM-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|