C13H24NNaO12 — CID 172856742
sodium;acetic acid;(2S)-2-aminopentanedioic acid;acetate (PubChem CID 172856742) has the molecular formula C13H24NNaO12 and a molecular weight of 409.32 g/mol. Its IUPAC name is sodium;acetic acid;(2S)-2-aminopentanedioic acid;acetate.
| Compound Name | sodium;acetic acid;(2S)-2-aminopentanedioic acid;acetate |
|---|---|
| PubChem CID | 172856742 |
| Molecular Formula | C13H24NNaO12 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | sodium;acetic acid;(2S)-2-aminopentanedioic acid;acetate |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)[O-].N[C@@H](CCC(=O)O)C(=O)O.[Na+] |
| InChI | InChI=1S/C5H9NO4.4C2H4O2.Na/c6-3(5(9)10)1-2-4(7)8;4*1-2(3)4;/h3H,1-2,6H2,(H,7,8)(H,9,10);4*1H3,(H,3,4);/q;;;;;+1/p-1/t3-;;;;;/m0...../s1 |
| InChIKey | YUPBAJCNNHIYIU-NBINMXDDSA-M |
| XLogP | -4.70 |
| TPSA | 252.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |