C13H25NO7 — CID 174950972
3-hydroxy-4-(trimethylazaniumyl)butanoate;3-methylpentanedioic acid (PubChem CID 174950972) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-hydroxy-4-(trimethylazaniumyl)butanoate;3-methylpentanedioic acid.
| Compound Name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;3-methylpentanedioic acid |
|---|---|
| PubChem CID | 174950972 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;3-methylpentanedioic acid |
| SMILES | CC(CC(=O)O)CC(=O)O.C[N+](C)(C)CC(O)CC(=O)[O-] |
| InChI | InChI=1S/C7H15NO3.C6H10O4/c1-8(2,3)5-6(9)4-7(10)11;1-4(2-5(7)8)3-6(9)10/h6,9H,4-5H2,1-3H3;4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | VPQANKANKPGESX-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|