C11H19NO7 — CID 75110711
(3-carboxy-2-hydroxypropyl)-trimethylazanium;4-hydroxy-4-oxobut-2-enoate (PubChem CID 75110711) has the molecular formula C11H19NO7 and a molecular weight of 277.27 g/mol. Its IUPAC name is (3-carboxy-2-hydroxypropyl)-trimethylazanium;4-hydroxy-4-oxobut-2-enoate.
| Compound Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 75110711 |
| Molecular Formula | C11H19NO7 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[N+](C)(C)CC(O)CC(=O)O.O=C([O-])C=CC(=O)O |
| InChI | InChI=1S/C7H15NO3.C4H4O4/c1-8(2,3)5-6(9)4-7(10)11;5-3(6)1-2-4(7)8/h6,9H,4-5H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HNSUOMBUJRUZHJ-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|