C14H30N2O5+2 — CID 87774567
(3-carboxy-2-hydroxypropyl)-trimethylazanium;3-carboxyprop-2-enyl(trimethyl)azanium (PubChem CID 87774567) has the molecular formula C14H30N2O5+2 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3-carboxy-2-hydroxypropyl)-trimethylazanium;3-carboxyprop-2-enyl(trimethyl)azanium.
| Compound Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;3-carboxyprop-2-enyl(trimethyl)azanium |
|---|---|
| PubChem CID | 87774567 |
| Molecular Formula | C14H30N2O5+2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;3-carboxyprop-2-enyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CC(O)CC(=O)O.C[N+](C)(C)CC=CC(=O)O |
| InChI | InChI=1S/C7H15NO3.C7H13NO2/c1-8(2,3)5-6(9)4-7(10)11;1-8(2,3)6-4-5-7(9)10/h6,9H,4-5H2,1-3H3;4-5H,6H2,1-3H3/p+2 |
| InChIKey | QPBYNNIYIGVNCO-UHFFFAOYSA-P |
| XLogP | -0.14 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|