C7H16ClNO3 — CID 162343685
[(2S)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (PubChem CID 162343685) has the molecular formula C7H16ClNO3 and a molecular weight of 200.68 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride.
| Compound Name | [(2S)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
|---|---|
| PubChem CID | 162343685 |
| Molecular Formula | C7H16ClNO3 |
| Molecular Weight | 200.68 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | [(2S)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](O)CC(=O)O.[Cl-] |
| InChI | InChI=1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H/t6-;/m0./s1/i1D3; |
| InChIKey | JXXCENBLGFBQJM-UPBCFZPRSA-N |
| XLogP | -3.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.68 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|