C10H20ClNO2 — CID 173117652
(2-hydroxy-4-oxohept-5-enyl)-trimethylazanium chloride (PubChem CID 173117652) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is (2-hydroxy-4-oxohept-5-enyl)-trimethylazanium chloride.
| Compound Name | (2-hydroxy-4-oxohept-5-enyl)-trimethylazanium chloride |
|---|---|
| PubChem CID | 173117652 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2-hydroxy-4-oxohept-5-enyl)-trimethylazanium chloride |
| SMILES | CC=CC(=O)CC(O)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C10H20NO2.ClH/c1-5-6-9(12)7-10(13)8-11(2,3)4;/h5-6,10,13H,7-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QYZLFBYECVECDX-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|