C9H17NO4 — CID 87749446
ethyl(trimethyl)azanium;(E)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 87749446) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;(E)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | ethyl(trimethyl)azanium;(E)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 87749446 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | ethyl(trimethyl)azanium;(E)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CC[N+](C)(C)C.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C5H14N.C4H4O4/c1-5-6(2,3)4;5-3(6)1-2-4(7)8/h5H2,1-4H3;1-2H,(H,5,6)(H,7,8)/q+1;/p-1/b;2-1+ |
| InChIKey | ZUIISDIYMJZVCG-WLHGVMLRSA-M |
| XLogP | -0.91 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|