C10H18KNO4 — CID 173150834
potassium;N,N-diethylethanamine;4-hydroxy-4-oxobut-2-enoate (PubChem CID 173150834) has the molecular formula C10H18KNO4 and a molecular weight of 255.35 g/mol. Its IUPAC name is potassium;N,N-diethylethanamine;4-hydroxy-4-oxobut-2-enoate.
| Compound Name | potassium;N,N-diethylethanamine;4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 173150834 |
| Molecular Formula | C10H18KNO4 |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | potassium;N,N-diethylethanamine;4-hydroxy-4-oxobut-2-enoate |
| SMILES | CCN(CC)CC.O=C([O-])C=CC(=O)O.[K+] |
| InChI | InChI=1S/C6H15N.C4H4O4.K/c1-4-7(5-2)6-3;5-3(6)1-2-4(7)8;/h4-6H2,1-3H3;1-2H,(H,5,6)(H,7,8);/q;;+1/p-1 |
| InChIKey | GBCLTJRGYCIYQD-UHFFFAOYSA-M |
| XLogP | -3.27 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|