About triazanium;(E)-but-2-enedioate;ethanolate
triazanium;(E)-but-2-enedioate;ethanolate (PubChem CID 141132724) has the molecular formula C6H19N3O5
and a molecular weight of 213.23 g/mol. Its IUPAC name is triazanium;(E)-but-2-enedioate;ethanolate.
Molecular Properties
| Compound Name | triazanium;(E)-but-2-enedioate;ethanolate |
| PubChem CID | 141132724 |
| Molecular Formula | C6H19N3O5 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | triazanium;(E)-but-2-enedioate;ethanolate |
| SMILES | CC[O-].O=C([O-])/C=C/C(=O)[O-].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H4O4.C2H5O.3H3N/c5-3(6)1-2-4(7)8;1-2-3;;;/h1-2H,(H,5,6)(H,7,8);2H2,1H3;3*1H3/q;-1;;;/p+1/b2-1+;;;; |
| InChIKey | SEYOUFPHDRDDGA-MBCFVHIPSA-O |
| XLogP | -2.46 |
| TPSA | 212.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze triazanium;(E)-but-2-enedioate;ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazanium;(E)-but-2-enedioate;ethanolate?
The IUPAC name of triazanium;(E)-but-2-enedioate;ethanolate (CID 141132724) is triazanium;(E)-but-2-enedioate;ethanolate.
What is the SMILES notation for triazanium;(E)-but-2-enedioate;ethanolate?
The canonical SMILES for triazanium;(E)-but-2-enedioate;ethanolate is CC[O-].O=C([O-])/C=C/C(=O)[O-].[NH4+].[NH4+].[NH4+].
What is the InChIKey of triazanium;(E)-but-2-enedioate;ethanolate?
The InChIKey is SEYOUFPHDRDDGA-MBCFVHIPSA-O. The full InChI is InChI=1S/C4H4O4.C2H5O.3H3N/c5-3(6)1-2-4(7)8;1-2-3;;;/h1-2H,(H,5,6)(H,7,8);2H2,1H3;3*1H3/q;-1;;;/p+1/b2-1+;;;;.
What are the key properties of triazanium;(E)-but-2-enedioate;ethanolate?
triazanium;(E)-but-2-enedioate;ethanolate has a molecular weight of 213.23 g/mol, XLogP of -2.46, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazanium;(E)-but-2-enedioate;ethanolate is sourced from PubChem (CID 141132724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).