About diazanium;(E)-but-2-enedioate;ethanol
diazanium;(E)-but-2-enedioate;ethanol (PubChem CID 172813479) has the molecular formula C6H16N2O5
and a molecular weight of 196.20 g/mol. Its IUPAC name is diazanium;(E)-but-2-enedioate;ethanol.
Molecular Properties
| Compound Name | diazanium;(E)-but-2-enedioate;ethanol |
| PubChem CID | 172813479 |
| Molecular Formula | C6H16N2O5 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | diazanium;(E)-but-2-enedioate;ethanol |
| SMILES | CCO.O=C([O-])/C=C/C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H4O4.C2H6O.2H3N/c5-3(6)1-2-4(7)8;1-2-3;;/h1-2H,(H,5,6)(H,7,8);3H,2H2,1H3;2*1H3/b2-1+;;; |
| InChIKey | SMRGZEASTLXVFX-YOTINIEPSA-N |
| XLogP | -2.21 |
| TPSA | 173.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diazanium;(E)-but-2-enedioate;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;(E)-but-2-enedioate;ethanol?
The IUPAC name of diazanium;(E)-but-2-enedioate;ethanol (CID 172813479) is diazanium;(E)-but-2-enedioate;ethanol.
What is the SMILES notation for diazanium;(E)-but-2-enedioate;ethanol?
The canonical SMILES for diazanium;(E)-but-2-enedioate;ethanol is CCO.O=C([O-])/C=C/C(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;(E)-but-2-enedioate;ethanol?
The InChIKey is SMRGZEASTLXVFX-YOTINIEPSA-N. The full InChI is InChI=1S/C4H4O4.C2H6O.2H3N/c5-3(6)1-2-4(7)8;1-2-3;;/h1-2H,(H,5,6)(H,7,8);3H,2H2,1H3;2*1H3/b2-1+;;;.
What are the key properties of diazanium;(E)-but-2-enedioate;ethanol?
diazanium;(E)-but-2-enedioate;ethanol has a molecular weight of 196.20 g/mol, XLogP of -2.21, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;(E)-but-2-enedioate;ethanol is sourced from PubChem (CID 172813479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).