C22H46N2O4 — CID 173189051
(Z)-but-2-enedioic acid;bis(N,N-dipropylpropan-1-amine) (PubChem CID 173189051) has the molecular formula C22H46N2O4 and a molecular weight of 402.62 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(N,N-dipropylpropan-1-amine).
| Compound Name | (Z)-but-2-enedioic acid;bis(N,N-dipropylpropan-1-amine) |
|---|---|
| PubChem CID | 173189051 |
| Molecular Formula | C22H46N2O4 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(N,N-dipropylpropan-1-amine) |
| SMILES | CCCN(CCC)CCC.CCCN(CCC)CCC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/2C9H21N.C4H4O4/c2*1-4-7-10(8-5-2)9-6-3;5-3(6)1-2-4(7)8/h2*4-9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | XIEGDCPLNRVBBN-KSBRXOFISA-N |
| XLogP | 4.75 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|