C28H58N2O4 — CID 173189126
(Z)-but-2-enedioic acid;bis(N,N-dibutylbutan-1-amine) (PubChem CID 173189126) has the molecular formula C28H58N2O4 and a molecular weight of 486.78 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(N,N-dibutylbutan-1-amine).
| Compound Name | (Z)-but-2-enedioic acid;bis(N,N-dibutylbutan-1-amine) |
|---|---|
| PubChem CID | 173189126 |
| Molecular Formula | C28H58N2O4 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.44 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(N,N-dibutylbutan-1-amine) |
| SMILES | CCCCN(CCCC)CCCC.CCCCN(CCCC)CCCC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/2C12H27N.C4H4O4/c2*1-4-7-10-13(11-8-5-2)12-9-6-3;5-3(6)1-2-4(7)8/h2*4-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | ZQSOMZQISQOLRQ-KSBRXOFISA-N |
| XLogP | 7.09 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|