About (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol
(E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol (PubChem CID 173031505) has the molecular formula C12H25NO4
and a molecular weight of 247.33 g/mol. Its IUPAC name is (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 173031505 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol |
| SMILES | C/C=C/C(=O)O.CCCCN(CCO)CCO |
| InChI | InChI=1S/C8H19NO2.C4H6O2/c1-2-3-4-9(5-7-10)6-8-11;1-2-3-4(5)6/h10-11H,2-8H2,1H3;2-3H,1H3,(H,5,6)/b;3-2+ |
| InChIKey | QYDKLDHVLUUYMD-ZPYUXNTASA-N |
| XLogP | 0.72 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol?
The IUPAC name of (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol (CID 173031505) is (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol is C/C=C/C(=O)O.CCCCN(CCO)CCO.
What is the InChIKey of (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol?
The InChIKey is QYDKLDHVLUUYMD-ZPYUXNTASA-N. The full InChI is InChI=1S/C8H19NO2.C4H6O2/c1-2-3-4-9(5-7-10)6-8-11;1-2-3-4(5)6/h10-11H,2-8H2,1H3;2-3H,1H3,(H,5,6)/b;3-2+.
What are the key properties of (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol?
(E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol has a molecular weight of 247.33 g/mol, XLogP of 0.72, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enoic acid;2-[butyl(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 173031505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).