About 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid
2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid (PubChem CID 173031673) has the molecular formula C11H23NO5
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid.
Molecular Properties
| Compound Name | 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid |
| PubChem CID | 173031673 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid |
| SMILES | CC(=O)C(=O)O.CCCCN(CCO)CCO |
| InChI | InChI=1S/C8H19NO2.C3H4O3/c1-2-3-4-9(5-7-10)6-8-11;1-2(4)3(5)6/h10-11H,2-8H2,1H3;1H3,(H,5,6) |
| InChIKey | ZFJHNNDWZFOEEA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid?
The IUPAC name of 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid (CID 173031673) is 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid.
What is the SMILES notation for 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid?
The canonical SMILES for 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid is CC(=O)C(=O)O.CCCCN(CCO)CCO.
What is the InChIKey of 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid?
The InChIKey is ZFJHNNDWZFOEEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2.C3H4O3/c1-2-3-4-9(5-7-10)6-8-11;1-2(4)3(5)6/h10-11H,2-8H2,1H3;1H3,(H,5,6).
What are the key properties of 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid?
2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid has a molecular weight of 249.31 g/mol, XLogP of -0.27, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl(2-hydroxyethyl)amino]ethanol;2-oxopropanoic acid is sourced from PubChem (CID 173031673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).