bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid

C16H40N2O8S — CID 173031476

IUPACbis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid
SMILESCCCCN(CCO)CCO.CCCCN(CCO)CCO.O=S(=O)(O)O
InChIInChI=1S/2C8H19NO2.H2O4S/c2*1-2-3-4-9(5-7-10)6-8-11;1-5(2,3)4/h2*10-11H,2-8H2,1H3;(H2,1,2,3,4)
InChIKeyMJGRIIXVSVVKGF-UHFFFAOYSA-N
MW420.57 g/mol
LogP-0.51
Rot. Bonds14

About bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid

bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid (PubChem CID 173031476) has the molecular formula C16H40N2O8S and a molecular weight of 420.57 g/mol. Its IUPAC name is bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid.

Molecular Properties

Compound Namebis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid
PubChem CID173031476
Molecular FormulaC16H40N2O8S
Molecular Weight420.57 g/mol
Exact Mass420.25
IUPAC Namebis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid
SMILESCCCCN(CCO)CCO.CCCCN(CCO)CCO.O=S(=O)(O)O
InChIInChI=1S/2C8H19NO2.H2O4S/c2*1-2-3-4-9(5-7-10)6-8-11;1-5(2,3)4/h2*10-11H,2-8H2,1H3;(H2,1,2,3,4)
InChIKeyMJGRIIXVSVVKGF-UHFFFAOYSA-N
XLogP-0.51
TPSA162.00 Ų
H-Bond Donors6
H-Bond Acceptors8
Rotatable Bonds14
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500420.57
LogP ≤ 5-0.51
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid?
The IUPAC name of bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid (CID 173031476) is bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid.
What is the SMILES notation for bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid?
The canonical SMILES for bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid is CCCCN(CCO)CCO.CCCCN(CCO)CCO.O=S(=O)(O)O.
What is the InChIKey of bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid?
The InChIKey is MJGRIIXVSVVKGF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H19NO2.H2O4S/c2*1-2-3-4-9(5-7-10)6-8-11;1-5(2,3)4/h2*10-11H,2-8H2,1H3;(H2,1,2,3,4).
What are the key properties of bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid?
bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid has a molecular weight of 420.57 g/mol, XLogP of -0.51, 14 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid is sourced from PubChem (CID 173031476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).