C16H40N2O8S — CID 173031476
bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid (PubChem CID 173031476) has the molecular formula C16H40N2O8S and a molecular weight of 420.57 g/mol. Its IUPAC name is bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid.
| Compound Name | bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid |
|---|---|
| PubChem CID | 173031476 |
| Molecular Formula | C16H40N2O8S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | bis(2-[butyl(2-hydroxyethyl)amino]ethanol);sulfuric acid |
| SMILES | CCCCN(CCO)CCO.CCCCN(CCO)CCO.O=S(=O)(O)O |
| InChI | InChI=1S/2C8H19NO2.H2O4S/c2*1-2-3-4-9(5-7-10)6-8-11;1-5(2,3)4/h2*10-11H,2-8H2,1H3;(H2,1,2,3,4) |
| InChIKey | MJGRIIXVSVVKGF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|