C36H80N2O4S — CID 71357248
bis(N,N-dihexylhexan-1-amine);sulfuric acid (PubChem CID 71357248) has the molecular formula C36H80N2O4S and a molecular weight of 637.11 g/mol. Its IUPAC name is bis(N,N-dihexylhexan-1-amine);sulfuric acid.
| Compound Name | bis(N,N-dihexylhexan-1-amine);sulfuric acid |
|---|---|
| PubChem CID | 71357248 |
| Molecular Formula | C36H80N2O4S |
| Molecular Weight | 637.11 g/mol |
| Exact Mass | 636.58 |
| IUPAC Name | bis(N,N-dihexylhexan-1-amine);sulfuric acid |
| SMILES | CCCCCCN(CCCCCC)CCCCCC.CCCCCCN(CCCCCC)CCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/2C18H39N.H2O4S/c2*1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3;1-5(2,3)4/h2*4-18H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | YQLDYKKMZGNACU-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.11 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|