C18H41NO4S — CID 172853690
N,N-dihexylhexan-1-amine;sulfuric acid (PubChem CID 172853690) has the molecular formula C18H41NO4S and a molecular weight of 367.60 g/mol. Its IUPAC name is N,N-dihexylhexan-1-amine;sulfuric acid.
| Compound Name | N,N-dihexylhexan-1-amine;sulfuric acid |
|---|---|
| PubChem CID | 172853690 |
| Molecular Formula | C18H41NO4S |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | N,N-dihexylhexan-1-amine;sulfuric acid |
| SMILES | CCCCCCN(CCCCCC)CCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C18H39N.H2O4S/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3;1-5(2,3)4/h4-18H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | YKHZKHAHXLGXDV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|