C9H23NO5S — CID 131862284
2-[butyl(2-hydroxyethyl)amino]ethanol;methanesulfonic acid (PubChem CID 131862284) has the molecular formula C9H23NO5S and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-[butyl(2-hydroxyethyl)amino]ethanol;methanesulfonic acid.
| Compound Name | 2-[butyl(2-hydroxyethyl)amino]ethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 131862284 |
| Molecular Formula | C9H23NO5S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[butyl(2-hydroxyethyl)amino]ethanol;methanesulfonic acid |
| SMILES | CCCCN(CCO)CCO.CS(=O)(=O)O |
| InChI | InChI=1S/C8H19NO2.CH4O3S/c1-2-3-4-9(5-7-10)6-8-11;1-5(2,3)4/h10-11H,2-8H2,1H3;1H3,(H,2,3,4) |
| InChIKey | YMSCTCKJKPETTK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|