About azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate
azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate (PubChem CID 139697277) has the molecular formula C4H9NO5
and a molecular weight of 151.12 g/mol. Its IUPAC name is azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate.
Molecular Properties
| Compound Name | azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate |
| PubChem CID | 139697277 |
| Molecular Formula | C4H9NO5 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate |
| SMILES | O.O=C([O-])/C=C\C(=O)O.[NH4+] |
| InChI | InChI=1S/C4H4O4.H3N.H2O/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);1H3;1H2/b2-1-;; |
| InChIKey | TUAXGDHEPKZEJA-UAIGNFCESA-N |
| XLogP | -2.07 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate?
The IUPAC name of azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate (CID 139697277) is azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate.
What is the SMILES notation for azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate?
The canonical SMILES for azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate is O.O=C([O-])/C=C\C(=O)O.[NH4+].
What is the InChIKey of azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate?
The InChIKey is TUAXGDHEPKZEJA-UAIGNFCESA-N. The full InChI is InChI=1S/C4H4O4.H3N.H2O/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);1H3;1H2/b2-1-;;.
What are the key properties of azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate?
azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate has a molecular weight of 151.12 g/mol, XLogP of -2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrate is sourced from PubChem (CID 139697277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).