C7H12KNO4 — CID 173151140
potassium;N,N-dimethylmethanamine;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 173151140) has the molecular formula C7H12KNO4 and a molecular weight of 213.27 g/mol. Its IUPAC name is potassium;N,N-dimethylmethanamine;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | potassium;N,N-dimethylmethanamine;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 173151140 |
| Molecular Formula | C7H12KNO4 |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | potassium;N,N-dimethylmethanamine;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CN(C)C.O=C([O-])/C=C\C(=O)O.[K+] |
| InChI | InChI=1S/C4H4O4.C3H9N.K/c5-3(6)1-2-4(7)8;1-4(2)3;/h1-2H,(H,5,6)(H,7,8);1-3H3;/q;;+1/p-1/b2-1-;; |
| InChIKey | MBJFOILRLVOXMP-UAIGNFCESA-M |
| XLogP | -4.44 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|