About (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium
(Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium (PubChem CID 88517646) has the molecular formula C12H23O4P
and a molecular weight of 262.29 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium.
Molecular Properties
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium |
| PubChem CID | 88517646 |
| Molecular Formula | C12H23O4P |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium |
| SMILES | CC[P+](CC)(CC)CC.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C8H20P.C4H4O4/c1-5-9(6-2,7-3)8-4;5-3(6)1-2-4(7)8/h5-8H2,1-4H3;1-2H,(H,5,6)(H,7,8)/q+1;/p-1/b;2-1- |
| InChIKey | SHEVJFMUCHWYHS-BTJKTKAUSA-M |
| XLogP | 1.46 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium?
The IUPAC name of (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium (CID 88517646) is (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium.
What is the SMILES notation for (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium?
The canonical SMILES for (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium is CC[P+](CC)(CC)CC.O=C([O-])/C=C\C(=O)O.
What is the InChIKey of (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium?
The InChIKey is SHEVJFMUCHWYHS-BTJKTKAUSA-M. The full InChI is InChI=1S/C8H20P.C4H4O4/c1-5-9(6-2,7-3)8-4;5-3(6)1-2-4(7)8/h5-8H2,1-4H3;1-2H,(H,5,6)(H,7,8)/q+1;/p-1/b;2-1-.
What are the key properties of (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium?
(Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium has a molecular weight of 262.29 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxy-4-oxobut-2-enoate;tetraethylphosphanium is sourced from PubChem (CID 88517646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).